| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 02:08:34 UTC |
|---|
| Update Date | 2025-03-21 20:48:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00363360 |
|---|
| Frequency | 5.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H11NO3 |
|---|
| Molecular Mass | 145.0739 |
|---|
| SMILES | CC(=C[N+](C)(C)[O-])C(=O)O |
|---|
| InChI Key | ORUWTDKQTZMHLO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | amines |
|---|
| Direct Parent | trisubstituted amine oxides and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganic oxoanionic compoundsorganonitrogen compoundsorganopnictogen compounds |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidcarboxylic acid derivativeorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundtrisubstituted n-oxideorganopnictogen compoundhydrocarbon derivativeorganooxygen compoundorganic hyponitrite |
|---|