| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 02:27:15 UTC |
|---|
| Update Date | 2025-03-21 20:56:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00407457 |
|---|
| Frequency | 4.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C41H82NO23P5 |
|---|
| Molecular Mass | 1111.3966 |
|---|
| SMILES | CCCCCCC=CCCCCCCCC(=O)NC(COC1C(OP(=O)(O)O)C(OP(=O)(O)O)C(OP(=O)(O)O)C(OP(=O)(O)O)C1OP(=O)(O)O)C(O)CCCCCCCC=CCCCCCCC |
|---|
| InChI Key | MPSKFRXNNOMVHE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | inositol phosphates |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acids and derivativesdialkyl ethershydrocarbon derivativesmonoalkyl phosphatesn-acyl aminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | fatty acylcarbonyl groupetherfatty amideinositol phosphatecarboxylic acid derivativedialkyl etherorganic oxideorganonitrogen compoundorganopnictogen compoundcarboxamide groupn-acyl-aminesecondary carboxylic acid amidephosphoric acid estermonoalkyl phosphatesecondary alcoholaliphatic homomonocyclic compoundhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
|---|
