| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 02:40:09 UTC |
|---|
| Update Date | 2025-03-21 21:54:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00438581 |
|---|
| Frequency | 4.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C31H54N7O15P3S |
|---|
| Molecular Mass | 889.2611 |
|---|
| SMILES | CCCC=CC=CC(=O)SCCNC(O)CCNC(C)C(O)C(C)(C)COP(=O)(O)OP(=O)(O)OCC1OC(n2cnc3c(N)ncnc32)C(O)C1CP(=O)(O)O |
|---|
| InChI Key | KEDUDLGQKWQQHA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleotides |
|---|
| Subclass | purine deoxyribonucleotides |
|---|
| Direct Parent | purine 3'-deoxyribonucleoside diphosphates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesazacyclic compoundscarbonyl compoundscarbothioic s-esterscarboxylic acids and derivativesdialkylaminesfatty acyl thioestershemiaminalsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonoalkyl phosphatesn-substituted imidazolesorganic oxidesorganic phosphonic acids and derivativesorganic pyrophosphatesorganophosphorus compoundsorganopnictogen compoundsoxacyclic compoundspentose phosphatesprimary aminespurines and purine derivativespyrimidines and pyrimidine derivativessecondary alcoholssulfenyl compoundstetrahydrofuransthioestersthiolactones |
|---|
| Substituents | carbonyl grouppentose phosphateamino acid or derivativesimidazopyrimidineorganosulfur compoundcarboxylic acid derivativehemiaminalpyrimidinecarbothioic s-esterorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundorganophosphorus compoundimidolactamfatty acyl thioesterthiolactoneorganophosphonic acid derivativeorganoheterocyclic compoundalkanolamineazolen-substituted imidazolealcoholsecondary aliphatic aminethiocarboxylic acid or derivativessulfenyl compoundazacycletetrahydrofuranthiocarboxylic acid esterheteroaromatic compoundpurine 3'-deoxyribonucleoside diphosphatesecondary amineorganic pyrophosphateoxacycleorganic oxygen compoundphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|