| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 02:55:51 UTC |
|---|
| Update Date | 2025-03-21 22:01:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00475393 |
|---|
| Frequency | 3.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H26N2O29P6 |
|---|
| Molecular Mass | 871.9047 |
|---|
| SMILES | O=c1ccn(C2OC(OP(=O)(O)OC3C(OP(=O)(O)O)C(OP(=O)(O)O)C(OP(=O)(O)O)C(OP(=O)(O)O)C3OP(=O)(O)O)C(O)C2O)c(=O)[nH]1 |
|---|
| InChI Key | HVFUHFNOYFENFG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | inositol phosphates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsdialkyl phosphatesheteroaromatic compoundshydrocarbon derivativeslactamsmonoalkyl phosphatesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspyrimidonessecondary alcoholstetrahydrofuransvinylogous amides |
|---|
| Substituents | lactamaromatic heteromonocyclic compoundmonosaccharidepyrimidoneinositol phosphatepyrimidinesaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compound1,2-diolvinylogous amidecarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundoxacycledialkyl phosphatephosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
|---|
