| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 03:06:15 UTC |
|---|
| Update Date | 2025-03-21 22:09:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00500192 |
|---|
| Frequency | 3.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C33H55N3O24 |
|---|
| Molecular Mass | 877.3176 |
|---|
| SMILES | CC(=O)NC1C(O)CC(OC2C(O)C(NC(C)=O)C(OC3C(O)C(CO)OC(OC(C(O)CO)C(O)C(O)C=O)C3O)C(NC(C)=O)C2O)(C(=O)O)OC1C(O)C(O)CO |
|---|
| InChI Key | VGEJKJIBXZVSCT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | streptamine aminoglycosides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesalkyl glycosidesalpha-hydroxyaldehydesbeta-hydroxy aldehydesc-glucuronidescarboxylic acidscyclitols and derivativescyclohexanolsdialkyl ethersfatty acyl glycosides of mono- and disaccharideshydrocarbon derivativesketalsmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholspyran carboxylic acidssecondary carboxylic acid amides |
|---|
| Substituents | fatty acylfatty acyl glycoside of mono- or disaccharidebeta-hydroxy aldehydecarbonyl groupethercarboxylic acidmonosaccharidecarboxylic acid derivativepyran carboxylic aciddialkyl etherorganic oxidealpha-hydroxyaldehydeacetalketalstreptamine aminoglycosidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundacetamidec-glucuronidealcoholpyran carboxylic acid or derivativesfatty acyl glycosidecyclohexanolaldehydecyclitol or derivativescyclic alcoholcarboxamide groupoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativespyransecondary alcoholhydrocarbon derivativeorganic nitrogen compoundalkyl glycoside |
|---|