Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 03:30:07 UTC |
---|
Update Date | 2025-03-21 22:20:25 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00556673 |
---|
Frequency | 3.0 |
---|
Structure | |
---|
Chemical Formula | C30H51NO38S4 |
---|
Molecular Mass | 1161.0972 |
---|
SMILES | CC(=O)NC1C(OC2C(O)C(O)OC(COS(=O)(=O)O)C(O)C2O)OC(COS(=O)(=O)O)C(OC2OC(COS(=O)(=O)O)C(O)C(OC3(C(=O)O)OC(COS(=O)(=O)O)C(O)C(C(O)C(O)CO)O3)C2O)C1O |
---|
InChI Key | LFLXFVNZDFDHNC-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | carbohydrates and carbohydrate conjugates |
---|
Direct Parent | n-acyl-alpha-hexosamines |
---|
Geometric Descriptor | aliphatic heteromonocyclic compounds |
---|
Alternative Parents | 1,3-dioxanesacetalsacetamidesalkyl sulfatescarbonyl compoundscarboxylic acid orthoesterscarboxylic acidshemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsortho estersoxacyclic compoundsoxanesoxepanesprimary alcoholssecondary alcoholssecondary carboxylic acid amidessulfuric acid monoesters |
---|
Substituents | sulfuric acid monoestercarbonyl groupcarboxylic acidortho estermonosaccharidecarboxylic acid orthoestercarboxylic acid derivativen-acyl-alpha-hexosamineorganic oxideacetalalkyl sulfatealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetalorthocarboxylic acid derivativeoxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholorganic sulfuric acid or derivativescarboxamide groupoxepaneoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativessecondary alcoholsulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid estermeta-dioxane |
---|