| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 03:38:00 UTC |
|---|
| Update Date | 2025-03-21 22:52:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00575585 |
|---|
| Frequency | 2.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C37H60N2O28 |
|---|
| Molecular Mass | 980.3333 |
|---|
| SMILES | CC(=O)NC1C(O)CC(OCC2CC(=O)NC3C(OC(CO)C(O)C4OC5OC(CO)C(O)C(O)C5OC(OC(C(O)CO)C(O)C(O)C=O)C4O)OC3C2O)(C(=O)O)OC1C(O)C(O)CO |
|---|
| InChI Key | JQIQAFQVSAYLDI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acyl glycosides |
|---|
| Direct Parent | fatty acyl glycosides of mono- and disaccharides |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,4-dioxepanesacetamidesalkyl glycosidesalpha-hydroxyaldehydesazacyclic compoundsazepanesbeta-hydroxy aldehydesc-glucuronidescaprolactamscarboxylic acidshydrocarbon derivativesketalsmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesoxetanesprimary alcoholspyran carboxylic acidssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | caprolactamfatty acyl glycoside of mono- or disaccharidebeta-hydroxy aldehydecarbonyl grouplactamcarboxylic acidmonosaccharidecarboxylic acid derivativepyran carboxylic acidaliphatic heteropolycyclic compoundsaccharideorganic oxidealpha-hydroxyaldehydeacetalketalorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundacetamidec-glucuronidealcoholpyran carboxylic acid or derivativesazacycle1,4-dioxepanealdehydecarboxamide groupdioxepaneoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativesazepaneorganic oxygen compoundpyranoxetanesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundalkyl glycoside |
|---|