| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 03:42:57 UTC |
|---|
| Update Date | 2025-03-21 22:54:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00587402 |
|---|
| Frequency | 2.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C27H46N2O30S3 |
|---|
| Molecular Mass | 974.1298 |
|---|
| SMILES | CC(=O)NC1C(O)C(OC2OC(COS(=O)(=O)O)C(O)C(OC3OC(COS(=O)(=O)O)C(O)C(O)C3O)O2)C(O)C(NC(C)=O)C1OC1C(O)C(O)OC(COS(=O)(=O)O)C1O |
|---|
| InChI Key | PBJPUDGNJKOGBR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dioxanesacetalsacetamidesalkyl sulfatescarbonyl compoundscarboxylic acid orthoesterscarboxylic acids and derivativescyclitols and derivativesdialkyl ethershemiacetalshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsortho estersoxacyclic compoundsoxanessecondary carboxylic acid amidessulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoestercarbonyl groupetherortho estermonosaccharidecarboxylic acid orthoestercarboxylic acid derivativedialkyl ethersaccharideorganic oxideacetalalkyl sulfatealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetalorthocarboxylic acid derivativeoxaneorganoheterocyclic compoundacetamideorganic sulfuric acid or derivativescyclohexanolcyclitol or derivativescyclic alcoholcarboxamide groupoxacyclesecondary carboxylic acid amidesulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid estermeta-dioxane |
|---|