| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 03:42:58 UTC |
|---|
| Update Date | 2025-03-21 22:54:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00587415 |
|---|
| Frequency | 2.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C42H72N2O31 |
|---|
| Molecular Mass | 1100.4119 |
|---|
| SMILES | CC(=O)NC1C(O)CC(OC2C(O)C(CO)OC(C(O)CO)OC3C(O)C(CO)OC4OC(CO)C(O)C(OC(C2O)C3NC(C)=O)C(O)C(C(OC2OC(C)C(O)C(O)C2O)C(O)C=O)O4)OC1C(O)C(O)CO |
|---|
| InChI Key | WNAWJIXGEGYROE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | orthocarboxylic acid derivatives |
|---|
| Subclass | carboxylic acid orthoesters |
|---|
| Direct Parent | carboxylic acid orthoesters |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalsacetamidesalpha-hydroxyaldehydescarboxylic acids and derivativesdialkyl ethershydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsortho estersoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupetherortho estermonosaccharidecarboxylic acid orthoestercarboxylic acid derivativedialkyl etheraliphatic heteropolycyclic compoundsaccharideorganic oxidealpha-hydroxyaldehydeacetalorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholaldehydecarboxamide groupoxacyclesecondary carboxylic acid amideorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|