| Record Information | 
|---|
| HMDB Status | Not Available | 
|---|
| Creation Date | 2024-02-21 03:57:53 UTC | 
|---|
| Update Date | 2025-03-21 23:01:44 UTC | 
|---|
| HMDB ID | Not Available | 
|---|
| Metabolite Identification | 
|---|
| DeepMet ID | DMID00622364 | 
|---|
| Frequency | 2.6 | 
|---|
| Structure |  | 
|---|
| Chemical Formula | C30H51N3O30S3 | 
|---|
| Molecular Mass | 1029.172 | 
|---|
| SMILES | CC(=O)NC1C(O)C(COS(=O)(=O)O)OC(OC2C(O)C(COS(=O)(=O)O)OC(OC3C(O)C(NC(C)=O)C(OC4C(O)C(O)OC(COS(=O)(=O)O)C4O)C(NC(C)=O)C3O)C2O)C1O | 
|---|
| InChI Key | XBHUNRUGBXXLNP-UHFFFAOYSA-N | 
|---|
| Chemical Taxonomy | 
|---|
| Kingdom | organic compounds | 
|---|
| Superclass | organic oxygen compounds | 
|---|
| Class | organooxygen compounds | 
|---|
| Subclass  | carbohydrates and carbohydrate conjugates | 
|---|
| Direct Parent  | streptamine aminoglycosides | 
|---|
| Geometric Descriptor  | aliphatic heteromonocyclic compounds | 
|---|
| Alternative Parents  | acetalsacetamidesalkyl sulfatescarbonyl compoundscarboxylic acids and derivativescyclitols and derivativescyclohexanolsdialkyl ethershemiacetalshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanessecondary carboxylic acid amidessulfuric acid monoesters | 
|---|
| Substituents  | sulfuric acid monoestercarbonyl groupethermonosaccharidecarboxylic acid derivativedialkyl etherorganic oxideacetalstreptamine aminoglycosidealkyl sulfatealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneorganoheterocyclic compoundacetamidealcoholorganic sulfuric acid or derivativescyclohexanolcyclitol or derivativescyclic alcoholcarboxamide groupoxacyclesecondary carboxylic acid amidesecondary alcoholsulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid ester | 
|---|