| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 04:00:05 UTC |
|---|
| Update Date | 2025-03-21 23:02:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00627459 |
|---|
| Frequency | 2.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C27H50N2O21P4S |
|---|
| Molecular Mass | 894.1577 |
|---|
| SMILES | CCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O)OP(=O)(O)OCC1OC(COP(=O)(O)O)C(O)C(O)C1CP(=O)(O)O |
|---|
| InChI Key | UUVKDKSAEUTJID-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | hexose phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | beta amino acids and derivativescarbonyl compoundscarbothioic s-esterscarboxylic acids and derivativesdialkyl ethersfatty acyl thioestershydrocarbon derivativesmonoalkyl phosphatesmonosaccharidesn-acyl aminesorganic oxidesorganic phosphonic acids and derivativesorganic pyrophosphatesorganonitrogen compoundsorganophosphorus compoundsorganopnictogen compoundsoxacyclic compoundsoxanessecondary alcoholssecondary carboxylic acid amidessulfenyl compoundsthioestersthiolactones |
|---|
| Substituents | fatty acylcarbonyl groupetherfatty amideorganosulfur compoundcarboxylic acid derivativedialkyl ethercarbothioic s-esterorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundorganophosphorus compoundoxanefatty acyl thioesterthiolactoneorganophosphonic acid derivativeorganoheterocyclic compoundalcoholthiocarboxylic acid or derivativessulfenyl compoundthiocarboxylic acid estercarboxamide groupn-acyl-aminebeta amino acid or derivativesorganic pyrophosphateoxacyclesecondary carboxylic acid amidephosphoric acid estermonoalkyl phosphatesecondary alcoholhexose phosphatehydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
|---|