| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 04:06:09 UTC |
|---|
| Update Date | 2025-03-21 23:07:35 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00641772 |
|---|
| Frequency | 2.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C33H56N2O34S3 |
|---|
| Molecular Mass | 1120.1877 |
|---|
| SMILES | CC(=O)NC1CC(OC2OC(OC3C(O)C(COS(=O)(=O)O)OC(OC(C(O)CO)C(O)C(O)C=O)C3O)C(NC(C)=O)C(OC3OC(COS(=O)(=O)O)C(O)C(O)C3O)C2O)C(COS(=O)(=O)O)OC1O |
|---|
| InChI Key | OSISXRAPTJUOAH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | acylaminosugars |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsacetamidesalkyl glycosidesalkyl sulfatesalpha-hydroxyaldehydesaminosaccharidesbeta-hydroxy aldehydescarboxylic acids and derivativesfatty acyl glycosides of mono- and disaccharideshemiacetalshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amidessulfuric acid monoesters |
|---|
| Substituents | fatty acylfatty acyl glycoside of mono- or disaccharidebeta-hydroxy aldehydesulfuric acid monoestercarbonyl groupmonosaccharidecarboxylic acid derivativeorganic oxidealpha-hydroxyaldehydeacetalalkyl sulfatealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholorganic sulfuric acid or derivativesfatty acyl glycosidealdehydecarboxamide groupacylaminosugaroxacyclesecondary carboxylic acid amidesecondary alcoholsulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid esteralkyl glycoside |
|---|
