| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 04:15:46 UTC |
|---|
| Update Date | 2025-03-21 23:12:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00664367 |
|---|
| Frequency | 2.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C46H72N12O9 |
|---|
| Molecular Mass | 936.5545 |
|---|
| SMILES | CC(C)CC(NC(=O)C(CCCNC(=N)N)NC(=O)C(CC(C)C)NC(=O)C(CC(C)C)NC(=O)C(Cc1ccccc1)NC(=O)CNC(=O)CNC(=O)C(N)Cc1ccc(O)cc1)C(N)=O |
|---|
| InChI Key | HWNOTURKMFIBGQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic polymers |
|---|
| Class | polypeptides |
|---|
| Subclass | polypeptides |
|---|
| Direct Parent | polypeptides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acid amidesalpha amino acidsamphetamines and derivativesarginine and derivativesbenzene and substituted derivativescarbonyl compoundscarboximidamidescarboxylic acids and derivativesguanidineshydrocarbon derivativesiminesleucine and derivativesmonoalkylaminesn-acyl aminesn-acyl-alpha amino acidsorganic oxidesorganopnictogen compoundspeptidesphenylalanine and derivativesprimary carboxylic acid amidessecondary carboxylic acid amidestyrosine and derivatives |
|---|
| Substituents | primary carboxylic acid amidefatty acylmonocyclic benzene moietycarbonyl groupguanidineiminefatty amide1-hydroxy-2-unsubstituted benzenoidalpha-amino acid or derivativescarboxylic acid derivativealpha peptideorganic oxidearginine or derivativesleucine or derivativesorganonitrogen compoundalpha-amino acidorganopnictogen compoundamphetamine or derivativesn-acyl-alpha amino acid or derivativespolypeptidetyrosine or derivativesalpha-amino acid amiden-acyl-alpha-amino acidcarboximidamidecarboxamide groupn-acyl-aminen-substituted-alpha-amino acidaromatic homomonocyclic compoundsecondary carboxylic acid amidephenylalanine or derivativesorganic oxygen compoundphenolhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|