| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 04:35:41 UTC |
|---|
| Update Date | 2025-03-24 13:58:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00712097 |
|---|
| Frequency | 2.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C36H59NO30 |
|---|
| Molecular Mass | 985.3122 |
|---|
| SMILES | CC(=O)NC1C(O)CC(OC2CC(OCC3OC(OC4C(O)C(CO)OC(OC(C(O)CO)C(O)C(O)C=O)C4O)OC(CO)C3O)(C(=O)O)C(O)C(O)C2O)(C(=O)O)OC1C(O)C(O)CO |
|---|
| InChI Key | KSTRAJBHOVTHQD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | tannins |
|---|
| Subclass | hydrolyzable tannins |
|---|
| Direct Parent | hydrolyzable tannins |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dioxanesacetamidesalkyl glycosidesalpha-hydroxyaldehydesbeta hydroxy acids and derivativesbeta-hydroxy aldehydesc-glucuronidescarboxylic acid orthoesterscarboxylic acidscyclohexanolsdialkyl ethersdicarboxylic acids and derivativesfatty acyl glycosides of mono- and disaccharideshydrocarbon derivativesketalsmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsortho estersoxacyclic compoundsoxanesprimary alcoholspyran carboxylic acidsquinic acids and derivativessecondary carboxylic acid amides |
|---|
| Substituents | fatty acyl glycoside of mono- or disaccharidecarboxylic acidmonosaccharidecarboxylic acid orthoesterpyran carboxylic aciddialkyl etherbeta-hydroxy acidsaccharideacetalketalorganonitrogen compoundorthocarboxylic acid derivativeoxaneorganoheterocyclic compoundacetamidehydrolyzable tanninc-glucuronidealcoholfatty acyl glycosidecyclohexanolcyclitol or derivativessecondary carboxylic acid amidedicarboxylic acid or derivativeshydrocarbon derivativemeta-dioxanequinic acidfatty acylbeta-hydroxy aldehydecarbonyl groupetherortho estercarboxylic acid derivativeorganic oxidealpha-hydroxyaldehydealiphatic heteromonocyclic compoundorganopnictogen compoundprimary alcoholpyran carboxylic acid or derivativesaldehydehydroxy acidcyclic alcoholcarboxamide groupoxacycleorganic oxygen compoundpyransecondary alcoholorganic nitrogen compoundorganooxygen compoundalkyl glycoside |
|---|