| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 05:16:15 UTC |
|---|
| Update Date | 2025-03-24 14:15:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00809235 |
|---|
| Frequency | 1.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C41H60N2O27 |
|---|
| Molecular Mass | 1012.3383 |
|---|
| SMILES | COc1cc(C=CC(=O)OC2OC(CO)C(O)C(OC3OC(COC4(C(=O)O)CC(O)C(NC(C)=O)C(C(O)C(O)CO)O4)C(O)C(OC4OC(CO)C(O)C(O)C4O)C3NC(C)=O)C2O)ccc1O |
|---|
| InChI Key | BWOFUVZBXFNPFE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | n-acyl-alpha-hexosamines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacetamidesalkyl aryl ethersanisolesc-glucuronidescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesenoate estersfatty acid estershydrocarbon derivativeshydroxycinnamic acidsketalsmethoxybenzenesmethoxyphenolsmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesphenoxy compoundsprimary alcoholspyran carboxylic acidssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarboxylic acidmethoxyphenolmonosaccharidepyran carboxylic acidalpha,beta-unsaturated carboxylic esteracetalketalorganonitrogen compoundoxaneorganoheterocyclic compoundacetamideenoate esterc-glucuronidealcoholmethoxybenzenesecondary carboxylic acid amidefatty acid esteranisolecarboxylic acid esterdicarboxylic acid or derivativesphenolhydrocarbon derivativephenoxy compoundfatty acylcarbonyl groupetheraromatic heteromonocyclic compound1-hydroxy-2-unsubstituted benzenoidalkyl aryl ethercarboxylic acid derivativehydroxycinnamic acid or derivativesn-acyl-alpha-hexosaminecinnamic acid or derivativesorganic oxideorganopnictogen compoundprimary alcoholpyran carboxylic acid or derivativescarboxamide grouphydroxycinnamic acidoxacyclepyransecondary alcoholbenzenoidorganic nitrogen compound |
|---|