| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 05:21:14 UTC |
|---|
| Update Date | 2025-03-24 14:17:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00821600 |
|---|
| Frequency | 1.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C3H5NO5-2 |
|---|
| Molecular Mass | 135.0179 |
|---|
| SMILES | O=C(O)CC[N+]([O-])([O-])[O-] |
|---|
| InChI Key | PMARMYPVLIADLZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | azonic acids and derivatives |
|---|
| Direct Parent | azonic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic anionsorganic oxidesorganic oxoanionic compoundsorganopnictogen compounds |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidcarboxylic acid derivativeorganic oxidemonocarboxylic acid or derivativesorganic anionorganic oxygen compoundorganopnictogen compoundhydrocarbon derivativeazonic acid or derivativesorganooxygen compoundorganic hyponitrite |
|---|
