| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 05:29:40 UTC |
|---|
| Update Date | 2025-03-24 14:27:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00842183 |
|---|
| Frequency | 1.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C27H52N2O21P4S |
|---|
| Molecular Mass | 896.1734 |
|---|
| SMILES | CCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O)O[PH](O)(O)OCC1OC(COP(=O)(O)O)C(O)C(O)C1CP(=O)(O)O |
|---|
| InChI Key | YNBNYBLDTLRGPK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | beta amino acids and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarbothioic s-esterscarboxylic acids and derivativesdialkyl ethersfatty acyl thioestershydrocarbon derivativesmonoalkyl phosphatesmonosaccharidesn-acyl aminesorganic oxidesorganic phosphonic acids and derivativesorganonitrogen compoundsorganophosphorus compoundsorganopnictogen compoundsoxacyclic compoundsoxanessecondary alcoholssecondary carboxylic acid amidessulfenyl compoundsthioestersthiolactones |
|---|
| Substituents | fatty acylcarbonyl groupetherfatty amidemonosaccharideorganosulfur compounddialkyl ethercarbothioic s-estersaccharideorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundorganophosphorus compoundoxanefatty acyl thioesterthiolactoneorganophosphonic acid derivativeorganoheterocyclic compoundalcoholthiocarboxylic acid or derivativessulfenyl compoundthiocarboxylic acid estercarboxamide groupn-acyl-aminebeta amino acid or derivativesoxacyclesecondary carboxylic acid amideorganic oxygen compoundphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|