DeepMet

Record Information
HMDB Status	Not Available
Creation Date	2024-02-21 05:55:12 UTC
Update Date	2025-03-24 14:38:42 UTC
HMDB ID	Not Available
Metabolite Identification
DeepMet ID	DMID00902790
Frequency	1.6
Structure
Chemical Formula	C₃₅H₅₉N₃O₄₁S₅
Molecular Mass	1337.1228
SMILES	COC1OC(COS(=O)(=O)O)C(OC2OC(C(=O)O)C(O)C(OC3OC(COS(=O)(=O)O)C(OC4OC(COS(=O)(=O)O)C(O)C(OC5OC(COS(=O)(=O)O)CC(O)C5NC(C)=O)C4O)C(O)C3NC(C)=O)C2O)C(O)C1NOS(=O)(=O)O
InChI Key	XDGFOPNHKSVPMZ-UHFFFAOYSA-N
Chemical Taxonomy
Kingdom	organic compounds
Superclass	organic oxygen compounds
Class	organooxygen compounds
Subclass	carbohydrates and carbohydrate conjugates
Direct Parent	n-acyl-alpha-hexosamines
Geometric Descriptor	aliphatic heteromonocyclic compounds
Alternative Parents	acetals acetamides alkyl sulfates beta hydroxy acids and derivatives carbonyl compounds carboxylic acids glucuronic acid derivatives hydrocarbon derivatives monocarboxylic acids and derivatives monosaccharides o-glucuronides organic oxides organonitrogen compounds organopnictogen compounds oxacyclic compounds oxanes pyran carboxylic acids secondary alcohols secondary carboxylic acid amides sulfuric acid monoesters
Substituents	sulfuric acid monoester carbonyl group carboxylic acid glucuronic acid or derivatives o-glucuronide monosaccharide carboxylic acid derivative pyran carboxylic acid n-acyl-alpha-hexosamine 1-o-glucuronide beta-hydroxy acid organic oxide acetal alkyl sulfate aliphatic heteromonocyclic compound organonitrogen compound organopnictogen compound oxane organoheterocyclic compound acetamide alcohol pyran carboxylic acid or derivatives organic sulfuric acid or derivatives hydroxy acid carboxamide group oxacycle secondary carboxylic acid amide monocarboxylic acid or derivatives pyran secondary alcohol sulfate-ester hydrocarbon derivative organic nitrogen compound sulfuric acid ester

Showing information for DMID00902790