| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 06:40:37 UTC |
|---|
| Update Date | 2025-03-24 17:55:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01011910 |
|---|
| Frequency | 1.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C60H88N16O12 |
|---|
| Molecular Mass | 1224.6768 |
|---|
| SMILES | CCC(C)C(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CC(=O)O)C(C)C)C(Cc1cnc[nH]1)N1CCCC1C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(CC(C)C)C(=O)O |
|---|
| InChI Key | VQRZIFNECLJMET-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic polymers |
|---|
| Class | polypeptides |
|---|
| Subclass | polypeptides |
|---|
| Direct Parent | polypeptides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acid amidesalpha amino acidsamino acidsamphetamines and derivativesaspartic acid and derivativesazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboximidamidescarboxylic acidsdicarboxylic acids and derivativesguanidinesheteroaromatic compoundshydrocarbon derivativesimidazolesleucine and derivativesmonoalkylaminesn-acyl aminesn-acyl-alpha amino acidsn-alkylpyrrolidinesorganic oxidesorganopnictogen compoundspeptidesphenylalanine and derivativesproline and derivativespropargyl-type 1,3-dipolar organic compoundspyrrolidinecarboxamidessecondary carboxylic acid amidestrialkylaminestyrosine and derivativesvaline and derivatives |
|---|
| Substituents | monocyclic benzene moietycarboxylic acidamino acid or derivativesalpha-amino acid or derivativesalpha peptideorganonitrogen compoundalpha-amino acidorganoheterocyclic compoundn-acyl-alpha amino acid or derivativespolypeptidetyrosine or derivativesalpha-amino acid amideazacyclen-acyl-alpha-amino acidvaline or derivativesheteroaromatic compoundtertiary aliphatic amineorganic 1,3-dipolar compoundn-substituted-alpha-amino acidsecondary carboxylic acid amidepyrrolidine carboxylic acid or derivativesaspartic acid or derivativesdicarboxylic acid or derivativesphenolhydrocarbon derivativeprimary aliphatic aminepyrrolidine-2-carboxamideaminefatty acylcarbonyl grouparomatic heteromonocyclic compoundamino acidguanidinefatty amide1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativepropargyl-type 1,3-dipolar organic compoundorganic oxideimidazoleleucine or derivativesorganopnictogen compoundpyrrolidinetertiary amineamphetamine or derivativesazoleproline or derivativesn-alkylpyrrolidinecarboximidamidecarboxamide groupn-acyl-aminephenylalanine or derivativesorganic oxygen compoundbenzenoidorganic nitrogen compoundorganooxygen compound |
|---|