| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 06:40:58 UTC |
|---|
| Update Date | 2025-03-24 17:55:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01012738 |
|---|
| Frequency | 1.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C38H66N2O29 |
|---|
| Molecular Mass | 1014.3751 |
|---|
| SMILES | CC(=O)NC1C(O)C(OC2OC(CO)C(O)C(O)C2O)C(OC2OC(C)C(O)C(O)C2O)C(NC2OC(CO)C(O)C(O)C2O)C1OC1C(O)C(CO)OC(OC2C(CO)OC(O)C(O)C2O)C1O |
|---|
| InChI Key | VEXSHUIQDPQJDO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | streptamine aminoglycosides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsacetamidesamino acids and derivativescarbonyl compoundscarboxylic acids and derivativescyclitols and derivativescyclohexanolsdialkyl ethersdialkylamineshemiacetalshemiaminalshydrocarbon derivativesmonosaccharidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupetheramino acid or derivativesmonosaccharidecarboxylic acid derivativedialkyl etherhemiaminalorganic oxideacetalstreptamine aminoglycosidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholsecondary aliphatic aminecyclohexanolcyclitol or derivativescyclic alcoholsecondary aminecarboxamide groupoxacyclesecondary carboxylic acid amidesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundamine |
|---|
