| Record Information | 
|---|
| HMDB Status | Not Available | 
|---|
| Creation Date | 2024-02-21 06:56:46 UTC | 
|---|
| Update Date | 2025-03-24 19:49:15 UTC | 
|---|
| HMDB ID | Not Available | 
|---|
| Metabolite Identification | 
|---|
| DeepMet ID | DMID01050450 | 
|---|
| Frequency | 1.3 | 
|---|
| Structure |  | 
|---|
| Chemical Formula | C38H66N2O30 | 
|---|
| Molecular Mass | 1030.37 | 
|---|
| SMILES | CC(=O)NC1C(O)CC(OC2C(O)C(CO)OC(OC3C(O)C(C(O)CO)OC(OC4C(O)C(CO)OC(OC(C(O)CO)C(O)C(O)CO)C4O)C3NC(C)=O)C2O)(C(=O)O)OC1C(O)C(O)CO | 
|---|
| InChI Key | DJDGHPUWGSZBQY-UHFFFAOYSA-N | 
|---|
| Chemical Taxonomy | 
|---|
| Kingdom | organic compounds | 
|---|
| Superclass | organic oxygen compounds | 
|---|
| Class | organooxygen compounds | 
|---|
| Subclass | carbohydrates and carbohydrate conjugates | 
|---|
| Direct Parent | n-acyl-alpha-hexosamines | 
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds | 
|---|
| Alternative Parents | acetamidesalkyl glycosidesc-glucuronidescarbonyl compoundscarboxylic acidsfatty acyl glycosides of mono- and disaccharideshydrocarbon derivativesketalsmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholspyran carboxylic acidssecondary alcoholssecondary carboxylic acid amides | 
|---|
| Substituents | fatty acylfatty acyl glycoside of mono- or disaccharidecarbonyl groupcarboxylic acidmonosaccharidecarboxylic acid derivativepyran carboxylic acidn-acyl-alpha-hexosamineorganic oxideacetalketalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundacetamidec-glucuronidealcoholpyran carboxylic acid or derivativesfatty acyl glycosidecarboxamide groupoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativespyransecondary alcoholhydrocarbon derivativeorganic nitrogen compoundalkyl glycoside | 
|---|