| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 07:06:36 UTC |
|---|
| Update Date | 2025-03-24 19:54:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01072716 |
|---|
| Frequency | 1.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C47H64N14O11S2 |
|---|
| Molecular Mass | 1064.432 |
|---|
| SMILES | N=C(O)CCC1NC(=O)C(Cc2ccccc2)NC(=O)C(Cc2ccc(O)cc2)NC(=O)C(N)CSSCC(C(=O)NC(Cc2ccc(O)cc2)NC(=O)C(N)CCCNC(=N)N)NC(=O)C(CC(=N)O)NC1=O |
|---|
| InChI Key | IMDYANGOAQSIGA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic polymers |
|---|
| Class | polypeptides |
|---|
| Subclass | polypeptides |
|---|
| Direct Parent | polypeptides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acid amidesalpha amino acidsarginine and derivativesazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboximidamidescarboximidic acidscarboxylic acids and derivativescyclic peptidesguanidineshydrocarbon derivativesimineslactamsmacrolactamsmonoalkylaminesn-acyl aminesorganic disulfidesorganic oxidesorganopnictogen compoundssecondary carboxylic acid amides |
|---|
| Substituents | fatty acylcarboximidic acidmonocyclic benzene moietycarbonyl grouplactamaromatic heteromonocyclic compoundguanidineiminefatty amide1-hydroxy-2-unsubstituted benzenoidalpha-amino acid or derivativescarboxylic acid derivativemacrolactamorganic oxidearginine or derivativesorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundpolypeptidealpha-amino acid amideazacyclecarboximidamidecarboxamide groupn-acyl-aminesecondary carboxylic acid amideorganic oxygen compoundcyclic alpha peptideorganic disulfidephenolhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|