Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 07:38:49 UTC |
---|
Update Date | 2025-03-24 22:18:19 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID01150959 |
---|
Frequency | 1.2 |
---|
Structure | |
---|
Chemical Formula | C46H66N14O11S2 |
---|
Molecular Mass | 1054.4477 |
---|
SMILES | N=C(N)NCCCC(=O)NC(CCC(N)=O)C1CCCN1C(=O)C1CSSCC(N)C(=O)NC(Cc2ccc(O)cc2)C(=O)NC(Cc2ccccc2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(N)=O)C(=O)N1 |
---|
InChI Key | GPRMGHAZVDSXEU-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | macrolactams |
---|
Subclass | macrolactams |
---|
Direct Parent | macrolactams |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acidsazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboximidamidescarboxylic acids and derivativesgamma amino acids and derivativesguanidineshydrocarbon derivativesimineslactamsmonoalkylaminesn-acyl aminesn-acylpyrrolidinesorganic disulfidesorganic oxidesorganopnictogen compoundspeptidomimeticsprimary carboxylic acid amidessecondary carboxylic acid amidestertiary carboxylic acid amides |
---|
Substituents | primary carboxylic acid amidefatty acylmonocyclic benzene moietycarbonyl grouplactamaromatic heteromonocyclic compoundgamma amino acid or derivativesguanidineiminefatty amiden-acylpyrrolidine1-hydroxy-2-unsubstituted benzenoidalpha-amino acid or derivativescarboxylic acid derivativemacrolactamnon-alpha peptideorganic oxidetertiary carboxylic acid amideorganonitrogen compoundalpha-amino acidorganopnictogen compoundpyrrolidineorganoheterocyclic compoundazacyclecarboximidamidecarboxamide groupn-acyl-aminesecondary carboxylic acid amideorganic oxygen compoundorganic disulfidephenolhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
---|