| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 08:09:10 UTC |
|---|
| Update Date | 2025-03-24 22:31:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01225661 |
|---|
| Frequency | 1.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C34H58N2O27 |
|---|
| Molecular Mass | 926.3227 |
|---|
| SMILES | CC(=O)NC1C(O)C(OC2C(O)C(O)C(O)C(COC3(C(=O)O)OC(C(O)C(O)CO)C(NC(C)=O)C(C(O)C(O)CO)O3)C2O)OC(CO)C1OC1OC(CO)C(O)C(O)C1O |
|---|
| InChI Key | YZCZBKFQRRGRKY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dioxanesacetalsacetamidescarbonyl compoundscarboxylic acid orthoesterscarboxylic acidscyclitols and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsortho estersoxacyclic compoundsoxanesprimary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupcarboxylic acidortho estermonosaccharidecarboxylic acid orthoestercarboxylic acid derivativesaccharideorganic oxideacetalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundorthocarboxylic acid derivativeoxaneprimary alcoholorganoheterocyclic compoundacetamidecyclohexanolcyclitol or derivativescyclic alcoholcarboxamide groupoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundmeta-dioxane |
|---|
