| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 08:09:38 UTC |
|---|
| Update Date | 2025-03-24 22:31:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01226895 |
|---|
| Frequency | 1.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C30H51NO37S4 |
|---|
| Molecular Mass | 1145.1023 |
|---|
| SMILES | CC(=O)NC1C(OC2C(O)CC(COS(=O)(=O)O)OC(O)C2O)OC(COS(=O)(=O)O)C(OC2OC(COS(=O)(=O)O)C(O)C(OC3(C(=O)O)OC(COS(=O)(=O)O)C(O)C(C(O)C(O)CO)O3)C2O)C1O |
|---|
| InChI Key | FQWIRESFJSSPLF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | n-acyl-alpha-hexosamines |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dioxanesacetalsacetamidesalkyl sulfatescarbonyl compoundscarboxylic acid orthoesterscarboxylic acidshemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsortho estersoxacyclic compoundsoxanesoxepanesprimary alcoholssecondary alcoholssecondary carboxylic acid amidessulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoestercarbonyl groupcarboxylic acidortho estermonosaccharidecarboxylic acid orthoestercarboxylic acid derivativen-acyl-alpha-hexosamineorganic oxideacetalalkyl sulfatealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetalorthocarboxylic acid derivativeoxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholorganic sulfuric acid or derivativescarboxamide groupoxepaneoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativessecondary alcoholsulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid estermeta-dioxane |
|---|