| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 08:24:02 UTC |
|---|
| Update Date | 2025-03-25 00:16:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01262165 |
|---|
| Frequency | 1.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C42H71N3O31 |
|---|
| Molecular Mass | 1113.4072 |
|---|
| SMILES | CC(=O)NC1C(O)CC(OCC2OC(OC3C(O)C(CO)OC(NC(C)C(O)C(O)C=O)C3O)C(NC(C)=O)C(OC3C(O)C(CO)OC(OC4C(CO)OC(O)C(O)C4O)C3O)C2O)(C(=O)O)OC1C(O)C(O)CO |
|---|
| InChI Key | AYSSDQPCHQIGCG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | n-acyl-alpha-hexosamines |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesalpha-hydroxyaldehydesamino acidsbeta-hydroxy aldehydesc-glucuronidescarboxylic acidsdialkyl ethersdialkylamineshemiacetalshemiaminalshydrocarbon derivativesketalsmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholspyran carboxylic acidssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | beta-hydroxy aldehydecarbonyl groupethercarboxylic acidamino acid or derivativesamino acidmonosaccharidecarboxylic acid derivativepyran carboxylic aciddialkyl etherhemiaminaln-acyl-alpha-hexosamineorganic oxidealpha-hydroxyaldehydeacetalketalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneprimary alcoholorganoheterocyclic compoundacetamidec-glucuronidealcoholsecondary aliphatic aminepyran carboxylic acid or derivativesaldehydesecondary aminecarboxamide groupoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativespyransecondary alcoholhydrocarbon derivativeorganic nitrogen compoundamine |
|---|