| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 08:48:59 UTC |
|---|
| Update Date | 2025-03-25 00:25:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01320793 |
|---|
| Frequency | 1.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C36H59NO29 |
|---|
| Molecular Mass | 969.3173 |
|---|
| SMILES | CC(=O)NC1C(OC2C(O)C(CO)OC(OC(=O)C(OC3OC(CO)C(O)C(O)C3O)C(O)C=O)C2O)OC(CO)C(OC2OC(CO)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O |
|---|
| InChI Key | RZBDOGVASQUCFI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | n-acyl-alpha-hexosamines |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsacetamidesalpha-hydroxyaldehydesbeta hydroxy acids and derivativescarboxylic acid estersfatty acid estersfatty acyl glycosides of mono- and disaccharideshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | fatty acylfatty acyl glycoside of mono- or disaccharidecarbonyl groupmonosaccharidecarboxylic acid derivativen-acyl-alpha-hexosaminebeta-hydroxy acidorganic oxidealpha-hydroxyaldehydeacetalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholfatty acyl glycosidealdehydehydroxy acidcarboxamide groupoxacyclesecondary carboxylic acid amidefatty acid estermonocarboxylic acid or derivativescarboxylic acid estersecondary alcoholhydrocarbon derivativeorganic nitrogen compound |
|---|