| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 08:54:42 UTC |
|---|
| Update Date | 2025-03-24 20:05:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01334735 |
|---|
| Frequency | 1.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C29H46N7O18P3S |
|---|
| Molecular Mass | 905.1833 |
|---|
| SMILES | CCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(=O)CO[PH](O)(O)OP(=O)(O)OCC1OC(n2cnc3c(N)ncnc32)C(O)C(O)C1CP(=O)(O)O |
|---|
| InChI Key | JTTDPRVBRXYZQP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | hexose phosphates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,3-dicarbonyl compoundsacyloinsalpha-hydroxy ketonesazacyclic compoundsbeta amino acids and derivativescarbothioic s-esterscarboxylic acids and derivativesfatty acyl thioestersheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonoalkyl phosphatesmonosaccharidesn-acyl aminesn-substituted imidazolesorganic oxidesorganic phosphonic acids and derivativesorganophosphorus compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary aminespurines and purine derivativespyrimidines and pyrimidine derivativessecondary alcoholssecondary carboxylic acid amidessulfenyl compoundsthioestersthiolactones |
|---|
| Substituents | amino acid or derivativesimidazopyrimidinealpha-hydroxy ketonecarbothioic s-esterketoneorganonitrogen compoundorganophosphorus compoundoxaneorganophosphonic acid derivativeorganoheterocyclic compoundalcoholsulfenyl compoundazacyclethiocarboxylic acid esterheteroaromatic compoundsecondary carboxylic acid amidemonoalkyl phosphatehydrocarbon derivativeprimary amine1,3-dicarbonyl compoundaminefatty acylcarbonyl groupfatty amideorganosulfur compoundcarboxylic acid derivativepyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganopnictogen compoundimidolactamfatty acyl thioesterthiolactoneazolen-substituted imidazolethiocarboxylic acid or derivativescarboxamide groupn-acyl-aminebeta amino acid or derivativesoxacyclephosphoric acid esteracyloinsecondary alcoholhexose phosphatepurineorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
|---|