| Record Information | 
|---|
| HMDB Status | Not Available | 
|---|
| Creation Date | 2024-02-21 09:26:31 UTC | 
|---|
| Update Date | 2025-03-24 20:19:29 UTC | 
|---|
| HMDB ID | Not Available | 
|---|
| Metabolite Identification | 
|---|
| DeepMet ID | DMID01410626 | 
|---|
| Frequency | 0.9 | 
|---|
| Structure |  | 
|---|
| Chemical Formula | C36H61N3O38S4 | 
|---|
| Molecular Mass | 1271.1816 | 
|---|
| SMILES | CC(=O)NC1C(OC2C(O)C(COS(=O)(=O)O)OC(OC3C(O)C(COS(=O)(=O)O)OC(OC4C(COS(=O)(=O)O)OC(OC5C(O)C(O)OC(COS(=O)(=O)O)C5O)C(NC(C)=O)C4O)C3O)C2NC(C)=O)OC(CO)C(O)C1O | 
|---|
| InChI Key | ZAWOIKJZEJVGML-UHFFFAOYSA-N | 
|---|
| Chemical Taxonomy | 
|---|
| Kingdom | organic compounds | 
|---|
| Superclass | organic oxygen compounds | 
|---|
| Class | organooxygen compounds | 
|---|
| Subclass | carbohydrates and carbohydrate conjugates | 
|---|
| Direct Parent | n-acyl-alpha-hexosamines | 
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds | 
|---|
| Alternative Parents | acetalsacetamidesalkyl sulfatescarbonyl compoundscarboxylic acids and derivativeshemiacetalshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amidessulfuric acid monoesters | 
|---|
| Substituents | sulfuric acid monoestercarbonyl groupmonosaccharidecarboxylic acid derivativen-acyl-alpha-hexosamineorganic oxideacetalalkyl sulfatealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholorganic sulfuric acid or derivativescarboxamide groupoxacyclesecondary carboxylic acid amidesecondary alcoholsulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid ester | 
|---|