Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 09:37:13 UTC |
---|
Update Date | 2025-03-24 20:23:58 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID01436296 |
---|
Frequency | 0.9 |
---|
Structure | |
---|
Chemical Formula | C44H74N2O35 |
---|
Molecular Mass | 1190.4072 |
---|
SMILES | CC(=O)NC1C(O)CC(OC2C(O)C(CO)OC(OC3C(O)C(CO)OC(OC4C(CO)OC(OC5C(O)C(CO)OC(OC6C(CO)OC(O)C(O)C6O)C5O)OC(CO)C4O)C3NC(C)=O)C2O)(C(=O)O)OC1C(O)C(O)CO |
---|
InChI Key | ZVYYITMPTWHLTR-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | carbohydrates and carbohydrate conjugates |
---|
Direct Parent | n-acyl-alpha-hexosamines |
---|
Geometric Descriptor | aliphatic heteromonocyclic compounds |
---|
Alternative Parents | 1,3-dioxepanesacetamidesc-glucuronidescarbonyl compoundscarboxylic acid orthoesterscarboxylic acidshemiacetalshydrocarbon derivativesketalsmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsortho estersoxacyclic compoundsoxanesprimary alcoholspyran carboxylic acidssecondary alcoholssecondary carboxylic acid amides |
---|
Substituents | 1,3-dioxepanecarbonyl groupcarboxylic acidortho estermonosaccharidecarboxylic acid orthoestercarboxylic acid derivativepyran carboxylic acidn-acyl-alpha-hexosamineorganic oxideacetalketalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetalorthocarboxylic acid derivativeoxaneprimary alcoholorganoheterocyclic compoundacetamidec-glucuronidealcoholpyran carboxylic acid or derivativescarboxamide groupdioxepaneoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativespyransecondary alcoholhydrocarbon derivativeorganic nitrogen compound |
---|