| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 09:37:54 UTC |
|---|
| Update Date | 2025-03-24 20:24:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01437858 |
|---|
| Frequency | 0.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C26H42N6O19P4S |
|---|
| Molecular Mass | 898.1176 |
|---|
| SMILES | CCCC=CC=CC(=O)SCCNC(=O)C(O)C(C)(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)OCC1OC(n2cnc3c(N)ncnc32)C(O)C1CP(=O)(O)O |
|---|
| InChI Key | QVGYLQYNSGWLJC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesazacyclic compoundscarbonyl compoundscarbothioic s-esterscarboxylic acids and derivativesfatty acyl thioestersheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonoalkyl phosphatesmonosaccharidesn-acyl aminesn-substituted imidazolesorganic oxidesorganic phosphonic acids and derivativesorganophosphorus compoundsorganopnictogen compoundsoxacyclic compoundsprimary aminespurines and purine derivativespyrimidines and pyrimidine derivativessecondary alcoholssecondary carboxylic acid amidessulfenyl compoundstertiary alcoholstetrahydrofuransthioestersthiolactones |
|---|
| Substituents | amino acid or derivativespentose-5-phosphateimidazopyrimidinecarbothioic s-esterorganonitrogen compoundorganophosphorus compoundorganophosphonic acid derivativeorganoheterocyclic compoundalcoholsulfenyl compoundazacyclethiocarboxylic acid esterheteroaromatic compoundsecondary carboxylic acid amidemonoalkyl phosphatehydrocarbon derivativeprimary amineaminefatty acylcarbonyl grouppentose phosphatefatty amideorganosulfur compoundcarboxylic acid derivativepyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganopnictogen compoundimidolactamfatty acyl thioesterthiolactoneazolen-substituted imidazolethiocarboxylic acid or derivativestetrahydrofurancarboxamide groupn-acyl-amineoxacycletertiary alcoholphosphoric acid estersecondary alcoholpurineorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
|---|