| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 09:40:35 UTC |
|---|
| Update Date | 2025-03-24 20:25:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01444263 |
|---|
| Frequency | 0.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C54H106N2O7P+ |
|---|
| Molecular Mass | 925.7732 |
|---|
| SMILES | CCCCCCC=CCCCCCCCC(=O)NC(COP(=O)(O)OCC[N+](C)(O)CCCCCCCC=CCCCCCCC)C(O)CCCCCCCC=CCCCCCCC |
|---|
| InChI Key | OPFUEISEJIGYGT-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | phosphoethanolamines |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acids and derivativesdialkyl phosphateshydrocarbon derivativesn-acyl aminesn-organohydroxylaminesorganic cationsorganic oxidesorganopnictogen compoundssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupfatty amidecarboxylic acid derivativephosphoethanolamineorganic oxideorganonitrogen compoundorganopnictogen compoundorganic cationalcoholcarboxamide groupn-organohydroxylaminen-acyl-aminesecondary carboxylic acid amidedialkyl phosphateorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundalkyl phosphateorganooxygen compound |
|---|