| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 09:58:13 UTC |
|---|
| Update Date | 2025-03-24 20:33:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01485284 |
|---|
| Frequency | 0.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C36H60N2O29 |
|---|
| Molecular Mass | 984.3282 |
|---|
| SMILES | CC(=O)NC1C(O)CC(OCC2OC(OC3C(O)C(CO)OC(OC4C(O)C(CO)OC(OC(O)C(C(=O)O)C(O)CO)C4O)C3NC(C)=O)C(O)C(O)C2O)(C(=O)O)OC1C(O)C(O)CO |
|---|
| InChI Key | KYJOQYBVEUMDAT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | saccharolipids |
|---|
| Subclass | saccharolipids |
|---|
| Direct Parent | saccharolipids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesbeta hydroxy acids and derivativesbranched fatty acidsc-glucuronidescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshemiacetalsheterocyclic fatty acidshydrocarbon derivativeshydroxy fatty acidsketalsmonosaccharidesn-acyl-alpha-hexosaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholspyran carboxylic acidssecondary alcoholssecondary carboxylic acid amidesshort-chain hydroxy acids and derivatives |
|---|
| Substituents | fatty acylcarbonyl groupcarboxylic acidshort-chain hydroxy acidheterocyclic fatty acidmonosaccharidefatty acidcarboxylic acid derivativepyran carboxylic acidn-acyl-alpha-hexosaminebeta-hydroxy acidsaccharideorganic oxideacetalketalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetalhydroxy fatty acidoxaneprimary alcoholorganoheterocyclic compoundacetamidec-glucuronidealcoholpyran carboxylic acid or derivativeshydroxy acidcarboxamide groupbranched fatty acidoxacyclesecondary carboxylic acid amideorganic oxygen compoundpyransecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundsaccharolipidorganooxygen compound |
|---|