| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 10:02:41 UTC |
|---|
| Update Date | 2025-03-24 20:34:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01495930 |
|---|
| Frequency | 0.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C33H56N2O25 |
|---|
| Molecular Mass | 880.3172 |
|---|
| SMILES | CC(=O)NC1C(O)C(OC2OC(CO)C(O)C(COC3OC(C)C(O)C(O)C3O)O2)C(O)C(NC(C)=O)C1OC1OC(OC(C(O)CO)C(O)C(O)C=O)OC(CO)C1O |
|---|
| InChI Key | MPVOWRDOPDLBAA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dioxanesacetalsacetamidesalpha-hydroxyaldehydesbeta-hydroxy aldehydescarboxylic acid orthoesterscarboxylic acids and derivativescyclitols and derivativeshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsortho estersoxacyclic compoundsoxanesprimary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | beta-hydroxy aldehydecarbonyl grouportho estermonosaccharidecarboxylic acid orthoestercarboxylic acid derivativesaccharideorganic oxidealpha-hydroxyaldehydeacetalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundorthocarboxylic acid derivativeoxaneprimary alcoholorganoheterocyclic compoundacetamidecyclohexanolaldehydecyclitol or derivativescyclic alcoholcarboxamide groupoxacyclesecondary carboxylic acid amidehydrocarbon derivativeorganic nitrogen compoundmeta-dioxane |
|---|