| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 10:04:17 UTC |
|---|
| Update Date | 2025-03-24 20:35:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01499847 |
|---|
| Frequency | 0.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C34H57N2O28P |
|---|
| Molecular Mass | 972.2835 |
|---|
| SMILES | CC(=O)NC1C(OC2C(O)C(CO)OC(OC(C(O)CO)C(O)C(O)C=O)C2O)OC(COP(=O)(O)OC2OC(CO)C(O)C(OC(C)C(=O)O)C2NC(C)=O)C(O)C1OC(C)C(=O)O |
|---|
| InChI Key | HFGVHECNLXKHMP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | n-acyl-alpha-hexosamines |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsacetamidesalkyl glycosidesalpha-hydroxyaldehydesbeta-hydroxy aldehydescarboxylic acidsdialkyl ethersdialkyl phosphatesdicarboxylic acids and derivativesfatty acyl glycosides of mono- and disaccharideshexose phosphateshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amidessugar acids and derivatives |
|---|
| Substituents | fatty acylfatty acyl glycoside of mono- or disaccharidebeta-hydroxy aldehydecarbonyl groupethercarboxylic acidmonosaccharidecarboxylic acid derivativedialkyl ethern-acyl-alpha-hexosaminemuramic_acidorganic oxidealpha-hydroxyaldehydeacetalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholfatty acyl glycosidealdehydecarboxamide groupoxacyclesecondary carboxylic acid amidedialkyl phosphatephosphoric acid estersecondary alcoholhexose phosphatedicarboxylic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphatealkyl glycoside |
|---|