| Record Information | 
|---|
| HMDB Status | Not Available | 
|---|
| Creation Date | 2024-02-21 10:35:49 UTC | 
|---|
| Update Date | 2025-03-24 20:49:18 UTC | 
|---|
| HMDB ID | Not Available | 
|---|
| Metabolite Identification | 
|---|
| DeepMet ID | DMID01576754 | 
|---|
| Frequency | 0.8 | 
|---|
| Structure |  | 
|---|
| Chemical Formula | C62H89N13O16 | 
|---|
| Molecular Mass | 1271.655 | 
|---|
| SMILES | CCC(C)C(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CC(=O)O)C(C)C)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(C(=O)NC(CO)C(=O)N1CCCC1C(=O)NC(Cc1ccccc1)C(=O)O)C(C)CC | 
|---|
| InChI Key | IRUYLTFMAVACMU-UHFFFAOYSA-N | 
|---|
| Chemical Taxonomy | 
|---|
| Kingdom | organic compounds | 
|---|
| Superclass | organic polymers | 
|---|
| Class | polypeptides | 
|---|
| Subclass | polypeptides | 
|---|
| Direct Parent | polypeptides | 
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds | 
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acid amidesalpha amino acidsamphetamines and derivativesaspartic acid and derivativesazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboximidamidescarboxylic acidsdicarboxylic acids and derivativesguanidineshydrocarbon derivativesisoleucine and derivativesmonoalkylaminesn-acyl aminesn-acyl-alpha amino acidsn-acylpyrrolidinesorganic oxidesorganopnictogen compoundspeptidesphenylalanine and derivativesphenylpropanoic acidsprimary alcoholsproline and derivativespropargyl-type 1,3-dipolar organic compoundspyrrolidinecarboxamidessecondary carboxylic acid amidestertiary carboxylic acid amidestyrosine and derivativesvaline and derivatives | 
|---|
| Substituents | monocyclic benzene moietycarboxylic acidalpha-amino acid or derivativesalpha peptideorganonitrogen compoundalpha-amino acidisoleucine or derivativesorganoheterocyclic compoundn-acyl-alpha amino acid or derivativesalcoholpolypeptidetyrosine or derivativesalpha-amino acid amideazacyclen-acyl-alpha-amino acidvaline or derivativesorganic 1,3-dipolar compoundn-substituted-alpha-amino acidsecondary carboxylic acid amidepyrrolidine carboxylic acid or derivativesaspartic acid or derivativesdicarboxylic acid or derivativesphenolhydrocarbon derivativeprimary aliphatic aminepyrrolidine-2-carboxamidefatty acylcarbonyl grouparomatic heteromonocyclic compound3-phenylpropanoic-acidguanidinefatty amiden-acylpyrrolidine1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativepropargyl-type 1,3-dipolar organic compoundorganic oxidetertiary carboxylic acid amideorganopnictogen compoundpyrrolidineprimary alcoholamphetamine or derivativesproline or derivativescarboximidamidecarboxamide groupn-acyl-aminephenylalanine or derivativesorganic oxygen compoundbenzenoidorganic nitrogen compoundorganooxygen compound | 
|---|