| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 10:36:38 UTC |
|---|
| Update Date | 2025-03-24 20:49:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01578616 |
|---|
| Frequency | 0.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C29H50N2O31S3 |
|---|
| Molecular Mass | 1018.156 |
|---|
| SMILES | CC(=O)NC1C(O)C(OC2OC(COS(=O)(=O)O)C(O)C(OC3OC(COS(=O)(=O)O)C(O)C(O)C3O)C(CO)O2)C(O)C(NC(C)=O)C1OC1C(O)C(O)OC(COS(=O)(=O)O)C1O |
|---|
| InChI Key | DYNQIAWADRMEMM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | dioxepanes |
|---|
| Subclass | 1,3-dioxepanes |
|---|
| Direct Parent | 1,3-dioxepanes |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsacetamidesalkyl sulfatescarbonyl compoundscarboxylic acid orthoesterscarboxylic acids and derivativescyclitols and derivativescyclohexanolsdialkyl ethershemiacetalshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsortho estersoxacyclic compoundsoxanesprimary alcoholssecondary carboxylic acid amidessulfuric acid monoesters |
|---|
| Substituents | 1,3-dioxepanesulfuric acid monoestercarbonyl groupetherortho estermonosaccharidecarboxylic acid orthoestercarboxylic acid derivativedialkyl ethersaccharideorganic oxideacetalalkyl sulfatealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetalorthocarboxylic acid derivativeoxaneprimary alcoholacetamidealcoholorganic sulfuric acid or derivativescyclohexanolcyclitol or derivativescyclic alcoholcarboxamide groupoxacyclesecondary carboxylic acid amideorganic oxygen compoundsecondary alcoholsulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid esterorganooxygen compound |
|---|