| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 10:36:53 UTC |
|---|
| Update Date | 2025-03-24 20:49:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01579190 |
|---|
| Frequency | 0.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C44H60N10O10S |
|---|
| Molecular Mass | 920.4215 |
|---|
| SMILES | CCC(C)C(NC(=O)C(CCSC)NC(=O)CNC(=O)CNC(=O)C(N)Cc1ccc(O)cc1)C(=O)NC(Cc1cnc[nH]1)C(=O)N1CCCC1C(=O)NC(Cc1ccccc1)C(=O)O |
|---|
| InChI Key | KTKAUCWKKXRSKG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic polymers |
|---|
| Class | polypeptides |
|---|
| Subclass | polypeptides |
|---|
| Direct Parent | polypeptides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acid amidesalpha amino acidsamphetamines and derivativesazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acidsdialkylthioethersheteroaromatic compoundshydrocarbon derivativesimidazolesisoleucine and derivativesmethionine and derivativesmonoalkylaminesmonocarboxylic acids and derivativesn-acyl aminesn-acyl-alpha amino acidsn-acylpyrrolidinesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspeptidesphenylalanine and derivativesphenylpropanoic acidsproline and derivativespyrrolidinecarboxamidessecondary carboxylic acid amidessulfenyl compoundstertiary carboxylic acid amidestyrosine and derivatives |
|---|
| Substituents | monocyclic benzene moietycarboxylic acidalpha-amino acid or derivativesalpha peptideorganonitrogen compoundalpha-amino acidisoleucine or derivativesorganoheterocyclic compoundn-acyl-alpha amino acid or derivativespolypeptidetyrosine or derivativesalpha-amino acid amidesulfenyl compoundazacyclen-acyl-alpha-amino aciddialkylthioetherheteroaromatic compoundn-substituted-alpha-amino acidsecondary carboxylic acid amidepyrrolidine carboxylic acid or derivativesthioethermethionine or derivativesphenolhydrocarbon derivativeprimary aliphatic aminepyrrolidine-2-carboxamidefatty acylcarbonyl grouparomatic heteromonocyclic compound3-phenylpropanoic-acidfatty amiden-acylpyrrolidine1-hydroxy-2-unsubstituted benzenoidorganosulfur compoundcarboxylic acid derivativeorganic oxideimidazoletertiary carboxylic acid amideorganopnictogen compoundpyrrolidineamphetamine or derivativesazoleproline or derivativescarboxamide groupn-acyl-aminemonocarboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compoundbenzenoidorganic nitrogen compoundorganooxygen compound |
|---|