| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 10:37:41 UTC |
|---|
| Update Date | 2025-03-24 20:50:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01581066 |
|---|
| Frequency | 0.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C39H50N10O11S2 |
|---|
| Molecular Mass | 898.3102 |
|---|
| SMILES | NC(=O)CCC1NC(=O)C2CSSCC(N)(CC1=O)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(Cc1ccccc1)C(=O)NC(CCC(N)=O)C(=O)NC(CC(N)=O)C(=O)N2 |
|---|
| InChI Key | CHEYKEUIWVYLOQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | peptidomimetics |
|---|
| Subclass | hybrid peptides |
|---|
| Direct Parent | hybrid peptides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acidsazacyclic compoundsbenzene and substituted derivativescarboxylic acids and derivativescyclic ketonesfatty amideshydrocarbon derivativeslactamsmacrolactamsmonoalkylaminesorganic disulfidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary carboxylic acid amidessecondary carboxylic acid amides |
|---|
| Substituents | primary carboxylic acid amidefatty acylmonocyclic benzene moietycarbonyl grouplactamfatty amide1-hydroxy-2-unsubstituted benzenoidcyclic ketonealpha-amino acid or derivativescarboxylic acid derivativemacrolactamketoneorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundazacyclecarboxamide groupsecondary carboxylic acid amideorganic oxygen compoundorganic disulfidehybrid peptidephenolhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
