| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 10:38:58 UTC |
|---|
| Update Date | 2025-03-24 20:50:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01584022 |
|---|
| Frequency | 0.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C42H60N14O10S2 |
|---|
| Molecular Mass | 984.4058 |
|---|
| SMILES | N=C(O)CCC1NC(=O)C(Cc2ccccc2)NC(=O)C(Cc2ccc(O)cc2)NC(=O)C(N)CSSCC(C(=O)N2CCCN2C(=O)C(N)CCCNC(=N)N)NC(=O)C(CC(=N)O)NC1=O |
|---|
| InChI Key | YJBNPNNOWNHCJY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic polymers |
|---|
| Class | polypeptides |
|---|
| Subclass | polypeptides |
|---|
| Direct Parent | polypeptides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acid amidesalpha amino acidsazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboximidamidescarboximidic acidscarboxylic acids and derivativescyclic peptidesdiacylhydrazinesguanidineshydrocarbon derivativesimineslactamsmacrolactamsmonoalkylaminesorganic disulfidesorganic oxidesorganopnictogen compoundspyrazolidinessecondary carboxylic acid amides |
|---|
| Substituents | carboximidic acidmonocyclic benzene moietycarboxylic acid hydrazidecarbonyl grouplactamaromatic heteromonocyclic compoundguanidineimine1-hydroxy-2-unsubstituted benzenoidalpha-amino acid or derivativescarboxylic acid derivativemacrolactamdiacylhydrazineorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundpolypeptidealpha-amino acid amidepyrazolidineazacyclecarboximidamidecarboxamide groupsecondary carboxylic acid amideorganic oxygen compoundcyclic alpha peptideorganic disulfidephenolhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
