| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 10:39:06 UTC |
|---|
| Update Date | 2025-03-24 20:50:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01584341 |
|---|
| Frequency | 0.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C32H54N2O33S3 |
|---|
| Molecular Mass | 1090.1771 |
|---|
| SMILES | CC(=O)NC1C(O)C(OC2OC(COS(=O)(=O)O)C(O)C(OC3(C(=O)O)OC(COS(C)(=O)=O)C(O)C(C(O)C(O)CO)O3)C2O)C(O)C(NC(C)=O)C1OC1C(O)C(O)OC(COS(=O)(=O)O)C1O |
|---|
| InChI Key | WNUQSHYNQSLSRB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | streptamine aminoglycosides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dioxanesacetalsacetamidesalkyl sulfatescarbonyl compoundscarboxylic acid orthoesterscarboxylic acidscyclitols and derivativescyclohexanolsdialkyl ethershemiacetalshydrocarbon derivativesmethanesulfonatesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsorganosulfonic acid estersortho estersoxacyclic compoundsoxanesprimary alcoholssecondary carboxylic acid amidessulfonic acid esterssulfonylssulfuric acid monoesters |
|---|
| Substituents | organosulfonic acid or derivativessulfuric acid monoestercarbonyl groupethercarboxylic acidortho estermonosaccharidecarboxylic acid orthoesterorganosulfur compoundcarboxylic acid derivativedialkyl ethersulfonic acid esterorganic oxideacetalstreptamine aminoglycosidealkyl sulfatealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetalorthocarboxylic acid derivativeoxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholorganic sulfuric acid or derivativescyclohexanolcyclitol or derivativescyclic alcoholcarboxamide grouporganosulfonic acid estermethanesulfonateoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativessulfonylorganic sulfonic acid or derivativessecondary alcoholsulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid estermeta-dioxane |
|---|