| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 10:39:14 UTC |
|---|
| Update Date | 2025-03-24 20:50:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01584648 |
|---|
| Frequency | 0.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C45H62N10O10 |
|---|
| Molecular Mass | 902.465 |
|---|
| SMILES | CCC(C)C(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CC(C)C)NC(=O)C(N)CC(N)=O)C(=O)NC(Cc1cnc[nH]1)C(=O)N1CCCC1C(=O)NC(Cc1ccccc1)C(=O)O |
|---|
| InChI Key | RNKXIKGEOLNKGL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic polymers |
|---|
| Class | polypeptides |
|---|
| Subclass | polypeptides |
|---|
| Direct Parent | polypeptides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acid amidesalpha amino acidsamphetamines and derivativesasparagine and derivativesazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesimidazolesisoleucine and derivativesleucine and derivativesmonoalkylaminesmonocarboxylic acids and derivativesn-acyl aminesn-acyl-alpha amino acidsn-acylpyrrolidinesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspeptidesphenylalanine and derivativesphenylpropanoic acidsprimary carboxylic acid amidesproline and derivativespyrrolidinecarboxamidessecondary carboxylic acid amidestertiary carboxylic acid amidestyrosine and derivatives |
|---|
| Substituents | monocyclic benzene moietycarboxylic acidalpha-amino acid or derivativesalpha peptideorganonitrogen compoundalpha-amino acidasparagine or derivativesisoleucine or derivativesorganoheterocyclic compoundn-acyl-alpha amino acid or derivativespolypeptidetyrosine or derivativesalpha-amino acid amideazacyclen-acyl-alpha-amino acidheteroaromatic compoundn-substituted-alpha-amino acidsecondary carboxylic acid amidepyrrolidine carboxylic acid or derivativesphenolhydrocarbon derivativeprimary aliphatic aminepyrrolidine-2-carboxamideprimary carboxylic acid amidefatty acylcarbonyl grouparomatic heteromonocyclic compound3-phenylpropanoic-acidfatty amiden-acylpyrrolidine1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeorganic oxideimidazoleleucine or derivativestertiary carboxylic acid amideorganopnictogen compoundpyrrolidineamphetamine or derivativesazoleproline or derivativescarboxamide groupn-acyl-aminemonocarboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compoundbenzenoidorganic nitrogen compoundorganooxygen compound |
|---|