| Record Information | 
|---|
| HMDB Status | Not Available | 
|---|
| Creation Date | 2024-02-21 10:39:55 UTC | 
|---|
| Update Date | 2025-03-24 20:50:59 UTC | 
|---|
| HMDB ID | Not Available | 
|---|
| Metabolite Identification | 
|---|
| DeepMet ID | DMID01586244 | 
|---|
| Frequency | 0.8 | 
|---|
| Structure |  | 
|---|
| Chemical Formula | C32H55NO40S5 | 
|---|
| Molecular Mass | 1253.0904 | 
|---|
| SMILES | CC(=O)NC1C(O)CC(COS(=O)(=O)O)OC1OC1C(O)C(COS(=O)(=O)O)OC(OC2C(O)C(COS(=O)(=O)O)OC(OC3C(O)C(COS(=O)(=O)O)OC(OC4C(O)C(O)OC(COS(=O)(=O)O)C4O)C3O)C2O)C1O | 
|---|
| InChI Key | WXLPVLZCANLXKI-UHFFFAOYSA-N | 
|---|
| Chemical Taxonomy | 
|---|
| Kingdom | organic compounds | 
|---|
| Superclass | organic oxygen compounds | 
|---|
| Class | organooxygen compounds | 
|---|
| Subclass  | carbohydrates and carbohydrate conjugates | 
|---|
| Direct Parent  | monosaccharides | 
|---|
| Geometric Descriptor  | aliphatic heteromonocyclic compounds | 
|---|
| Alternative Parents  | acetalsacetamidesalkyl sulfatescarbonyl compoundscarboxylic acids and derivativeshemiacetalshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanessecondary alcoholssecondary carboxylic acid amidessulfuric acid monoesters | 
|---|
| Substituents  | sulfuric acid monoestercarbonyl groupmonosaccharidecarboxylic acid derivativeorganic oxideacetalalkyl sulfatealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneorganoheterocyclic compoundacetamidealcoholorganic sulfuric acid or derivativescarboxamide groupoxacyclesecondary carboxylic acid amidesecondary alcoholsulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid ester | 
|---|