| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 10:41:56 UTC |
|---|
| Update Date | 2025-03-24 20:51:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01590730 |
|---|
| Frequency | 0.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C43H73N2O36P |
|---|
| Molecular Mass | 1224.3681 |
|---|
| SMILES | CC(=O)NC1C(O)CC(OCC2OC(C(O)CO)C(O)C(OC3CC(OC4(C(=O)O)CC(OC5(C(=O)O)CC(OP(=O)(O)OCCN)C(O)C(C(O)CO)O5)C(O)C(C(O)CO)O4)C(O)C(CO)O3)C2O)(C(=O)O)OC1C(O)C(O)CO |
|---|
| InChI Key | SRMPLUMAMCNCMH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | c-glucuronides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidescarbonyl compoundscarboxylic acidsdialkyl ethersdialkyl phosphateshydrocarbon derivativesketalsmonoalkylaminesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesphosphoethanolaminesprimary alcoholspyran carboxylic acidssecondary alcoholssecondary carboxylic acid amidestricarboxylic acids and derivatives |
|---|
| Substituents | carbonyl groupethercarboxylic acidmonosaccharidetricarboxylic acid or derivativescarboxylic acid derivativepyran carboxylic aciddialkyl etherphosphoethanolamineorganic oxideacetalketalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundacetamidec-glucuronidealcoholpyran carboxylic acid or derivativescarboxamide groupoxacyclesecondary carboxylic acid amidedialkyl phosphatephosphoric acid esterpyransecondary alcoholhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
|---|