| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 11:02:20 UTC |
|---|
| Update Date | 2025-03-24 21:00:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01639271 |
|---|
| Frequency | 0.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C44H46N4O15 |
|---|
| Molecular Mass | 870.296 |
|---|
| SMILES | CC1=C(CCC(=O)O)C2=Cc3[nH]c(c(CCC(=O)O)c3CC(=O)O)C=C3N=C(C=c4[nH]c(c(CCC(=O)O)c4CCC(=O)O)=CC(C(=O)CCC(=O)O)=N2)C(CCC(=O)O)=C3CC1 |
|---|
| InChI Key | GSIGUUOWUGAHRS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | keto acids and derivatives |
|---|
| Subclass | gamma-keto acids and derivatives |
|---|
| Direct Parent | gamma-keto acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aryl alkyl ketonesazacyclic compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrroles |
|---|
| Substituents | carbonyl groupcarboxylic acidaryl alkyl ketoneazacycleheteroaromatic compoundcarboxylic acid derivativegamma-keto acidketoneorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyrroleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compoundaryl ketone |
|---|
