| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 11:03:12 UTC |
|---|
| Update Date | 2025-03-24 21:00:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01641431 |
|---|
| Frequency | 0.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C36H52N6O16P2S |
|---|
| Molecular Mass | 918.2636 |
|---|
| SMILES | CCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O)OP(=O)(O)OCC(O)C(O)C(O)Cn1c2nc(=O)[nH]c(=O)c-2nc2cc(C)c(C)cc21 |
|---|
| InChI Key | FQVJAUAFTKLOON-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | flavin nucleotides |
|---|
| Subclass | flavin nucleotides |
|---|
| Direct Parent | flavin nucleotides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzenoidsbeta amino acids and derivativescarbonyl compoundscarbothioic s-esterscarboxylic acids and derivativesdiazanaphthalenesfatty acyl thioestersflavinsheteroaromatic compoundshydrocarbon derivativeslactamsmonoalkyl phosphatesmonosaccharidesn-acyl aminesorganic carbonic acids and derivativesorganic oxidesorganic pyrophosphatesorganonitrogen compoundsorganopnictogen compoundspyrazinespyrimidonesquinoxalinessecondary alcoholssecondary carboxylic acid amidessulfenyl compoundsthioestersthiolactones |
|---|
| Substituents | fatty acylcarbonyl grouplactamfatty amidemonosaccharidepyrimidoneorganosulfur compoundpteridinecarboxylic acid derivativeisoalloxazineflavinpyrimidinecarbothioic s-estersaccharideorganic oxidediazanaphthalenearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundfatty acyl thioesterthiolactoneorganoheterocyclic compoundalcoholquinoxalinethiocarboxylic acid or derivativescarbonic acid derivativesulfenyl compoundazacycleflavin nucleotidethiocarboxylic acid esterheteroaromatic compoundcarboxamide groupn-acyl-aminebeta amino acid or derivativesorganic pyrophosphatesecondary carboxylic acid amideorganic oxygen compoundphosphoric acid estermonoalkyl phosphatepyrazinesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|