| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 11:11:12 UTC |
|---|
| Update Date | 2025-03-24 21:04:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01660777 |
|---|
| Frequency | 0.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C57H112N2O7P+ |
|---|
| Molecular Mass | 967.8202 |
|---|
| SMILES | CCCCCCC=CCCCCCCCC(=O)NC(CO[PH](O)(OCC[N+](C)(C)C)OC(=O)CCCCCCCC=CCCCCCC)C(O)CCCCCCCC=CCCCCCCCC |
|---|
| InChI Key | ZVZPYKXUXFHNHL-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty amides |
|---|
| Direct Parent | n-acyl amines |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | aminescarbonyl compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundssecondary alcoholssecondary carboxylic acid amidestetraalkylammonium salts |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl grouptetraalkylammonium saltquaternary ammonium saltcarboxamide groupcarboxylic acid derivativen-acyl-aminesecondary carboxylic acid amideorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic cationorganic saltamineorganooxygen compound |
|---|
