| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 11:16:33 UTC |
|---|
| Update Date | 2025-03-24 21:06:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01673697 |
|---|
| Frequency | 0.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C33H57NO26 |
|---|
| Molecular Mass | 883.3169 |
|---|
| SMILES | CC(=O)NC1C(OC2C(CO)OC(COC3OC(CO)C(O)C(O)C3O)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(OC2OC(CO)C(O)C(O)C2O)C(CO)O1 |
|---|
| InChI Key | KWOZZIOSUSNXKO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | n-acyl-alpha-hexosamines |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dioxepanesacetalsacetamidescarbonyl compoundscarboxylic acid orthoesterscarboxylic acids and derivativesdialkyl ethershydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsortho estersoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | 1,3-dioxepanecarbonyl groupetherortho estermonosaccharidecarboxylic acid orthoestercarboxylic acid derivativedialkyl ethern-acyl-alpha-hexosamineorganic oxideacetalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundorthocarboxylic acid derivativeoxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholtetrahydrofurancarboxamide groupdioxepaneoxacyclesecondary carboxylic acid amidesecondary alcoholhydrocarbon derivativeorganic nitrogen compound |
|---|