| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 11:51:28 UTC |
|---|
| Update Date | 2025-03-24 21:22:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID01757626 |
|---|
| Frequency | 0.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C51H92NO6PS |
|---|
| Molecular Mass | 877.6383 |
|---|
| SMILES | CCCCCC=CCC=CC=CC=CC(COP(=O)(O)O)SCC(NC(=O)CCCCCCCC=CCCCCCC)C(O)CCCCCCCC=CCCCCCCC |
|---|
| InChI Key | JWXFHMORPMMDLH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | monoalkyl phosphates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acids and derivativesdialkylthioethershydrocarbon derivativesn-acyl aminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary alcoholssecondary carboxylic acid amidessulfenyl compounds |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupfatty amideorganosulfur compoundcarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundalcoholsulfenyl compounddialkylthioethercarboxamide groupn-acyl-aminesecondary carboxylic acid amideorganic oxygen compoundthioethermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
