Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 11:53:47 UTC |
---|
Update Date | 2025-03-24 21:23:35 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID01763002 |
---|
Frequency | 0.7 |
---|
Structure | |
---|
Chemical Formula | C58H96N20O11 |
---|
Molecular Mass | 1248.7567 |
---|
SMILES | CCC(C)C(NC(=O)C(CCCNC(=N)N)NC(=O)C(CCCNC(=N)N)NC(=O)C(CCCNC(=N)N)NC(=O)C(CC(C)C)NC(=O)C(Cc1ccccc1)NC(=O)CNC(=O)CNC(=O)C(N)Cc1ccc(O)cc1)C(=O)NC(CC(C)C)C(N)=O |
---|
InChI Key | WLEKODWGGYPPLV-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic polymers |
---|
Class | polypeptides |
---|
Subclass | polypeptides |
---|
Direct Parent | polypeptides |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acid amidesalpha amino acidsamphetamines and derivativesarginine and derivativesbenzene and substituted derivativescarbonyl compoundscarboximidamidescarboxylic acids and derivativesguanidineshydrocarbon derivativesiminesisoleucine and derivativesleucine and derivativesmonoalkylaminesn-acyl aminesn-acyl-alpha amino acidsorganic oxidesorganopnictogen compoundspeptidesphenylalanine and derivativesprimary carboxylic acid amidessecondary carboxylic acid amidestyrosine and derivatives |
---|
Substituents | primary carboxylic acid amidefatty acylmonocyclic benzene moietycarbonyl groupguanidineiminefatty amide1-hydroxy-2-unsubstituted benzenoidalpha-amino acid or derivativescarboxylic acid derivativealpha peptideorganic oxidearginine or derivativesleucine or derivativesorganonitrogen compoundalpha-amino acidorganopnictogen compoundisoleucine or derivativesamphetamine or derivativesn-acyl-alpha amino acid or derivativespolypeptidetyrosine or derivativesalpha-amino acid amiden-acyl-alpha-amino acidcarboximidamidecarboxamide groupn-acyl-aminen-substituted-alpha-amino acidaromatic homomonocyclic compoundsecondary carboxylic acid amidephenylalanine or derivativesorganic oxygen compoundphenolhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
---|